C45H81N9O6 — CID 70542561
N-(2,2,6,6-tetramethylpiperidin-4-yl)-5-[2,4,6-trioxo-3,5-bis[5-oxo-5-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pentyl]-1,3,5-triazinan-1-yl]pentanamide (PubChem CID 70542561) has the molecular formula C45H81N9O6 and a molecular weight of 844.20 g/mol. Its IUPAC name is N-(2,2,6,6-tetramethylpiperidin-4-yl)-5-[2,4,6-trioxo-3,5-bis[5-oxo-5-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pentyl]-1,3,5-triazinan-1-yl]pentanamide.
| Compound Name | N-(2,2,6,6-tetramethylpiperidin-4-yl)-5-[2,4,6-trioxo-3,5-bis[5-oxo-5-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pentyl]-1,3,5-triazinan-1-yl]pentanamide |
|---|---|
| PubChem CID | 70542561 |
| Molecular Formula | C45H81N9O6 |
| Molecular Weight | 844.20 g/mol |
| Exact Mass | 843.63 |
| IUPAC Name | N-(2,2,6,6-tetramethylpiperidin-4-yl)-5-[2,4,6-trioxo-3,5-bis[5-oxo-5-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pentyl]-1,3,5-triazinan-1-yl]pentanamide |
| SMILES | CC1(C)CC(NC(=O)CCCCn2c(=O)n(CCCCC(=O)NC3CC(C)(C)NC(C)(C)C3)c(=O)n(CCCCC(=O)NC3CC(C)(C)NC(C)(C)C3)c2=O)CC(C)(C)N1 |
| InChI | InChI=1S/C45H81N9O6/c1-40(2)25-31(26-41(3,4)49-40)46-34(55)19-13-16-22-52-37(58)53(23-17-14-20-35(56)47-32-27-42(5,6)50-43(7,8)28-32)39(60)54(38(52)59)24-18-15-21-36(57)48-33-29-44(9,10)51-45(11,12)30-33/h31-33,49-51H,13-30H2,1-12H3,(H,46,55)(H,47,56)(H,48,57) |
| InChIKey | RGXSSJYYPBZZGK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 189.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.20 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|