C23H36N2O2 — CID 70542857
bis(1-methyl-3,4,4a,5-tetrahydro-2H-quinolin-6-yl)methanol;methoxymethane (PubChem CID 70542857) has the molecular formula C23H36N2O2 and a molecular weight of 372.55 g/mol. Its IUPAC name is bis(1-methyl-3,4,4a,5-tetrahydro-2H-quinolin-6-yl)methanol;methoxymethane.
| Compound Name | bis(1-methyl-3,4,4a,5-tetrahydro-2H-quinolin-6-yl)methanol;methoxymethane |
|---|---|
| PubChem CID | 70542857 |
| Molecular Formula | C23H36N2O2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | bis(1-methyl-3,4,4a,5-tetrahydro-2H-quinolin-6-yl)methanol;methoxymethane |
| SMILES | CN1CCCC2CC(C(O)C3=CC=C4C(CCCN4C)C3)=CC=C21.COC |
| InChI | InChI=1S/C21H30N2O.C2H6O/c1-22-11-3-5-15-13-17(7-9-19(15)22)21(24)18-8-10-20-16(14-18)6-4-12-23(20)2;1-3-2/h7-10,15-16,21,24H,3-6,11-14H2,1-2H3;1-2H3 |
| InChIKey | DMMKHKCEIDWGJY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |