C16H19NO4S — CID 70542870
(7S,9aS)-7-(3,4-dimethoxyphenyl)-3,4,7,8,9,9a-hexahydropyrrolo[2,1-c][1,4]thiazepine-1,5-dione (PubChem CID 70542870) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is (7S,9aS)-7-(3,4-dimethoxyphenyl)-3,4,7,8,9,9a-hexahydropyrrolo[2,1-c][1,4]thiazepine-1,5-dione.
| Compound Name | (7S,9aS)-7-(3,4-dimethoxyphenyl)-3,4,7,8,9,9a-hexahydropyrrolo[2,1-c][1,4]thiazepine-1,5-dione |
|---|---|
| PubChem CID | 70542870 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (7S,9aS)-7-(3,4-dimethoxyphenyl)-3,4,7,8,9,9a-hexahydropyrrolo[2,1-c][1,4]thiazepine-1,5-dione |
| SMILES | COc1ccc([C@@H]2CC[C@H]3C(=O)SCCC(=O)N32)cc1OC |
| InChI | InChI=1S/C16H19NO4S/c1-20-13-6-3-10(9-14(13)21-2)11-4-5-12-16(19)22-8-7-15(18)17(11)12/h3,6,9,11-12H,4-5,7-8H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | PRGBJRYBADGGPY-RYUDHWBXSA-N |
| XLogP | 2.40 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|