C22H26O9 — CID 70543005
4,5-dihydroxy-7-(2-hydroxypropoxy)-7-oxo-2,6-diphenoxyheptanoic acid (PubChem CID 70543005) has the molecular formula C22H26O9 and a molecular weight of 434.44 g/mol. Its IUPAC name is 4,5-dihydroxy-7-(2-hydroxypropoxy)-7-oxo-2,6-diphenoxyheptanoic acid.
| Compound Name | 4,5-dihydroxy-7-(2-hydroxypropoxy)-7-oxo-2,6-diphenoxyheptanoic acid |
|---|---|
| PubChem CID | 70543005 |
| Molecular Formula | C22H26O9 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 4,5-dihydroxy-7-(2-hydroxypropoxy)-7-oxo-2,6-diphenoxyheptanoic acid |
| SMILES | CC(O)COC(=O)C(Oc1ccccc1)C(O)C(O)CC(Oc1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H26O9/c1-14(23)13-29-22(28)20(31-16-10-6-3-7-11-16)19(25)17(24)12-18(21(26)27)30-15-8-4-2-5-9-15/h2-11,14,17-20,23-25H,12-13H2,1H3,(H,26,27) |
| InChIKey | JIUSFDTZKDVUEA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |