About 1-(furan-2-yl)indole
1-(furan-2-yl)indole (PubChem CID 70543237) has the molecular formula C12H9NO
and a molecular weight of 183.21 g/mol. Its IUPAC name is 1-(furan-2-yl)indole.
Molecular Properties
| Compound Name | 1-(furan-2-yl)indole |
| PubChem CID | 70543237 |
| Molecular Formula | C12H9NO |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 1-(furan-2-yl)indole |
| SMILES | c1coc(-n2ccc3ccccc32)c1 |
| InChI | InChI=1S/C12H9NO/c1-2-5-11-10(4-1)7-8-13(11)12-6-3-9-14-12/h1-9H |
| InChIKey | SMRIPDVOSQYEON-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(furan-2-yl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(furan-2-yl)indole?
The IUPAC name of 1-(furan-2-yl)indole (CID 70543237) is 1-(furan-2-yl)indole.
What is the SMILES notation for 1-(furan-2-yl)indole?
The canonical SMILES for 1-(furan-2-yl)indole is c1coc(-n2ccc3ccccc32)c1.
What is the InChIKey of 1-(furan-2-yl)indole?
The InChIKey is SMRIPDVOSQYEON-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO/c1-2-5-11-10(4-1)7-8-13(11)12-6-3-9-14-12/h1-9H.
What are the key properties of 1-(furan-2-yl)indole?
1-(furan-2-yl)indole has a molecular weight of 183.21 g/mol, XLogP of 3.22, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(furan-2-yl)indole is sourced from PubChem (CID 70543237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).