C10H16O8 — CID 70543387
(4S,5S)-4-hydroxy-5-[(4R,5S)-5-hydroxy-1,3-dioxan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid (PubChem CID 70543387) has the molecular formula C10H16O8 and a molecular weight of 264.23 g/mol. Its IUPAC name is (4S,5S)-4-hydroxy-5-[(4R,5S)-5-hydroxy-1,3-dioxan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid.
| Compound Name | (4S,5S)-4-hydroxy-5-[(4R,5S)-5-hydroxy-1,3-dioxan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 70543387 |
| Molecular Formula | C10H16O8 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | (4S,5S)-4-hydroxy-5-[(4R,5S)-5-hydroxy-1,3-dioxan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
| SMILES | CC1(C)O[C@@H]([C@@H]2OCOC[C@@H]2O)[C@@](O)(C(=O)O)O1 |
| InChI | InChI=1S/C10H16O8/c1-9(2)17-7(10(14,18-9)8(12)13)6-5(11)3-15-4-16-6/h5-7,11,14H,3-4H2,1-2H3,(H,12,13)/t5-,6+,7-,10-/m0/s1 |
| InChIKey | JPDKMFLRJUSAER-XIVUIJJLSA-N |
| XLogP | -1.36 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |