C13H16N2O5 — CID 70544353
5-(3-acetylcyclohexyl)-2,4-dioxo-1H-pyrimidine-6-carboxylic acid (PubChem CID 70544353) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 5-(3-acetylcyclohexyl)-2,4-dioxo-1H-pyrimidine-6-carboxylic acid.
| Compound Name | 5-(3-acetylcyclohexyl)-2,4-dioxo-1H-pyrimidine-6-carboxylic acid |
|---|---|
| PubChem CID | 70544353 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 5-(3-acetylcyclohexyl)-2,4-dioxo-1H-pyrimidine-6-carboxylic acid |
| SMILES | CC(=O)C1CCCC(c2c(C(=O)O)[nH]c(=O)[nH]c2=O)C1 |
| InChI | InChI=1S/C13H16N2O5/c1-6(16)7-3-2-4-8(5-7)9-10(12(18)19)14-13(20)15-11(9)17/h7-8H,2-5H2,1H3,(H,18,19)(H2,14,15,17,20) |
| InChIKey | OPEQHZZTLJJDQN-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |