C18H24O — CID 70544439
4,4-di(cyclohexa-1,5-dien-1-yl)-2,2-dimethyloxolane (PubChem CID 70544439) has the molecular formula C18H24O and a molecular weight of 256.39 g/mol. Its IUPAC name is 4,4-di(cyclohexa-1,5-dien-1-yl)-2,2-dimethyloxolane.
| Compound Name | 4,4-di(cyclohexa-1,5-dien-1-yl)-2,2-dimethyloxolane |
|---|---|
| PubChem CID | 70544439 |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 4,4-di(cyclohexa-1,5-dien-1-yl)-2,2-dimethyloxolane |
| SMILES | CC1(C)CC(C2=CCCC=C2)(C2=CCCC=C2)CO1 |
| InChI | InChI=1S/C18H24O/c1-17(2)13-18(14-19-17,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h5,7,9-12H,3-4,6,8,13-14H2,1-2H3 |
| InChIKey | MSFIZPKEKNGEEQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |