C9H11NO3 — CID 70544548
(2R)-2-(furan-2-yl)pyrrolidine-2-carboxylic acid (PubChem CID 70544548) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is (2R)-2-(furan-2-yl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-2-(furan-2-yl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70544548 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | (2R)-2-(furan-2-yl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@]1(c2ccco2)CCCN1 |
| InChI | InChI=1S/C9H11NO3/c11-8(12)9(4-2-5-10-9)7-3-1-6-13-7/h1,3,6,10H,2,4-5H2,(H,11,12)/t9-/m1/s1 |
| InChIKey | YIFVHPOCYBGPAW-SECBINFHSA-N |
| XLogP | 0.94 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |