benzene;silicic acid

C6H10O4Si — CID 70544717

IUPACbenzene;silicic acid
SMILESO[Si](O)(O)O.c1ccccc1
InChIInChI=1S/C6H6.H4O4Si/c1-2-4-6-5-3-1;1-5(2,3)4/h1-6H;1-4H
InChIKeyXNSFQAKLQDHNHB-UHFFFAOYSA-N
MW174.23 g/mol
LogP-0.92
Rot. Bonds

About benzene;silicic acid

benzene;silicic acid (PubChem CID 70544717) has the molecular formula C6H10O4Si and a molecular weight of 174.23 g/mol. Its IUPAC name is benzene;silicic acid.

Molecular Properties

Compound Namebenzene;silicic acid
PubChem CID70544717
Molecular FormulaC6H10O4Si
Molecular Weight174.23 g/mol
Exact Mass174.03
IUPAC Namebenzene;silicic acid
SMILESO[Si](O)(O)O.c1ccccc1
InChIInChI=1S/C6H6.H4O4Si/c1-2-4-6-5-3-1;1-5(2,3)4/h1-6H;1-4H
InChIKeyXNSFQAKLQDHNHB-UHFFFAOYSA-N
XLogP-0.92
TPSA80.92 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.23
LogP ≤ 5-0.92
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze benzene;silicic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzene;silicic acid?
The IUPAC name of benzene;silicic acid (CID 70544717) is benzene;silicic acid.
What is the SMILES notation for benzene;silicic acid?
The canonical SMILES for benzene;silicic acid is O[Si](O)(O)O.c1ccccc1.
What is the InChIKey of benzene;silicic acid?
The InChIKey is XNSFQAKLQDHNHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6.H4O4Si/c1-2-4-6-5-3-1;1-5(2,3)4/h1-6H;1-4H.
What are the key properties of benzene;silicic acid?
benzene;silicic acid has a molecular weight of 174.23 g/mol, XLogP of -0.92, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;silicic acid is sourced from PubChem (CID 70544717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).