C34H51F3O3P+ — CID 70545260
tricyclopentyl-[6-methyl-7-oxo-5-phenyl-10-(2,2,2-trifluoroacetyl)oxydecyl]phosphanium (PubChem CID 70545260) has the molecular formula C34H51F3O3P+ and a molecular weight of 595.75 g/mol. Its IUPAC name is tricyclopentyl-[6-methyl-7-oxo-5-phenyl-10-(2,2,2-trifluoroacetyl)oxydecyl]phosphanium.
| Compound Name | tricyclopentyl-[6-methyl-7-oxo-5-phenyl-10-(2,2,2-trifluoroacetyl)oxydecyl]phosphanium |
|---|---|
| PubChem CID | 70545260 |
| Molecular Formula | C34H51F3O3P+ |
| Molecular Weight | 595.75 g/mol |
| Exact Mass | 595.35 |
| IUPAC Name | tricyclopentyl-[6-methyl-7-oxo-5-phenyl-10-(2,2,2-trifluoroacetyl)oxydecyl]phosphanium |
| SMILES | CC(C(=O)CCCOC(=O)C(F)(F)F)C(CCCC[P+](C1CCCC1)(C1CCCC1)C1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C34H51F3O3P/c1-26(32(38)23-13-24-40-33(39)34(35,36)37)31(27-14-3-2-4-15-27)22-11-12-25-41(28-16-5-6-17-28,29-18-7-8-19-29)30-20-9-10-21-30/h2-4,14-15,26,28-31H,5-13,16-25H2,1H3/q+1 |
| InChIKey | KMESCKAHWVLSIJ-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.75 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|