C12H13N5O2 — CID 70545373
2-ethyl-3-oxo-6-pyridin-4-ylpyridazine-4-carbohydrazide (PubChem CID 70545373) has the molecular formula C12H13N5O2 and a molecular weight of 259.27 g/mol. Its IUPAC name is 2-ethyl-3-oxo-6-pyridin-4-ylpyridazine-4-carbohydrazide.
| Compound Name | 2-ethyl-3-oxo-6-pyridin-4-ylpyridazine-4-carbohydrazide |
|---|---|
| PubChem CID | 70545373 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-ethyl-3-oxo-6-pyridin-4-ylpyridazine-4-carbohydrazide |
| SMILES | CCn1nc(-c2ccncc2)cc(C(=O)NN)c1=O |
| InChI | InChI=1S/C12H13N5O2/c1-2-17-12(19)9(11(18)15-13)7-10(16-17)8-3-5-14-6-4-8/h3-7H,2,13H2,1H3,(H,15,18) |
| InChIKey | PUYLMOOXJPZYLP-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|