About ethyl N-[(Z)-3-(4-chloro-2,6-dimethylanilino)-2-cyanoprop-2-enoyl]carbamate
ethyl N-[(Z)-3-(4-chloro-2,6-dimethylanilino)-2-cyanoprop-2-enoyl]carbamate (PubChem CID 70545798) has the molecular formula C15H16ClN3O3
and a molecular weight of 321.76 g/mol. Its IUPAC name is ethyl N-[(Z)-3-(4-chloro-2,6-dimethylanilino)-2-cyanoprop-2-enoyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(Z)-3-(4-chloro-2,6-dimethylanilino)-2-cyanoprop-2-enoyl]carbamate |
| PubChem CID | 70545798 |
| Molecular Formula | C15H16ClN3O3 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | ethyl N-[(Z)-3-(4-chloro-2,6-dimethylanilino)-2-cyanoprop-2-enoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)/C(C#N)=C\Nc1c(C)cc(Cl)cc1C |
| InChI | InChI=1S/C15H16ClN3O3/c1-4-22-15(21)19-14(20)11(7-17)8-18-13-9(2)5-12(16)6-10(13)3/h5-6,8,18H,4H2,1-3H3,(H,19,20,21)/b11-8- |
| InChIKey | ZBQQFMQTWFEQKZ-FLIBITNWSA-N |
| XLogP | 3.05 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[(Z)-3-(4-chloro-2,6-dimethylanilino)-2-cyanoprop-2-enoyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(Z)-3-(4-chloro-2,6-dimethylanilino)-2-cyanoprop-2-enoyl]carbamate?
The IUPAC name of ethyl N-[(Z)-3-(4-chloro-2,6-dimethylanilino)-2-cyanoprop-2-enoyl]carbamate (CID 70545798) is ethyl N-[(Z)-3-(4-chloro-2,6-dimethylanilino)-2-cyanoprop-2-enoyl]carbamate.
What is the SMILES notation for ethyl N-[(Z)-3-(4-chloro-2,6-dimethylanilino)-2-cyanoprop-2-enoyl]carbamate?
The canonical SMILES for ethyl N-[(Z)-3-(4-chloro-2,6-dimethylanilino)-2-cyanoprop-2-enoyl]carbamate is CCOC(=O)NC(=O)/C(C#N)=C\Nc1c(C)cc(Cl)cc1C.
What is the InChIKey of ethyl N-[(Z)-3-(4-chloro-2,6-dimethylanilino)-2-cyanoprop-2-enoyl]carbamate?
The InChIKey is ZBQQFMQTWFEQKZ-FLIBITNWSA-N. The full InChI is InChI=1S/C15H16ClN3O3/c1-4-22-15(21)19-14(20)11(7-17)8-18-13-9(2)5-12(16)6-10(13)3/h5-6,8,18H,4H2,1-3H3,(H,19,20,21)/b11-8-.
What are the key properties of ethyl N-[(Z)-3-(4-chloro-2,6-dimethylanilino)-2-cyanoprop-2-enoyl]carbamate?
ethyl N-[(Z)-3-(4-chloro-2,6-dimethylanilino)-2-cyanoprop-2-enoyl]carbamate has a molecular weight of 321.76 g/mol, XLogP of 3.05, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(Z)-3-(4-chloro-2,6-dimethylanilino)-2-cyanoprop-2-enoyl]carbamate is sourced from PubChem (CID 70545798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).