C12H15NO — CID 70546057
6-methoxy-1,2,3,8,8a,8b-hexahydroindeno[2,1-b]pyrrole (PubChem CID 70546057) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 6-methoxy-1,2,3,8,8a,8b-hexahydroindeno[2,1-b]pyrrole.
| Compound Name | 6-methoxy-1,2,3,8,8a,8b-hexahydroindeno[2,1-b]pyrrole |
|---|---|
| PubChem CID | 70546057 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 6-methoxy-1,2,3,8,8a,8b-hexahydroindeno[2,1-b]pyrrole |
| SMILES | COC1=CCC2C(=C1)C=C1NCCC12 |
| InChI | InChI=1S/C12H15NO/c1-14-9-2-3-10-8(6-9)7-12-11(10)4-5-13-12/h2,6-7,10-11,13H,3-5H2,1H3 |
| InChIKey | KIZQWNBVUURYLV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |