About 9,9-dipropyl-5,8-dihydro-4H-azecine
9,9-dipropyl-5,8-dihydro-4H-azecine (PubChem CID 70546472) has the molecular formula C15H25N
and a molecular weight of 219.37 g/mol. Its IUPAC name is 9,9-dipropyl-5,8-dihydro-4H-azecine.
Molecular Properties
| Compound Name | 9,9-dipropyl-5,8-dihydro-4H-azecine |
| PubChem CID | 70546472 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 9,9-dipropyl-5,8-dihydro-4H-azecine |
| SMILES | CCCC1(CCC)/C=N/C=CCCC=CC1 |
| InChI | InChI=1S/C15H25N/c1-3-10-15(11-4-2)12-8-6-5-7-9-13-16-14-15/h6,8-9,13-14H,3-5,7,10-12H2,1-2H3/b8-6?,13-9?,16-14+ |
| InChIKey | WNZNHRMRXOXZHG-QABVFLJBSA-N |
| XLogP | 4.90 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9,9-dipropyl-5,8-dihydro-4H-azecine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9-dipropyl-5,8-dihydro-4H-azecine?
The IUPAC name of 9,9-dipropyl-5,8-dihydro-4H-azecine (CID 70546472) is 9,9-dipropyl-5,8-dihydro-4H-azecine.
What is the SMILES notation for 9,9-dipropyl-5,8-dihydro-4H-azecine?
The canonical SMILES for 9,9-dipropyl-5,8-dihydro-4H-azecine is CCCC1(CCC)/C=N/C=CCCC=CC1.
What is the InChIKey of 9,9-dipropyl-5,8-dihydro-4H-azecine?
The InChIKey is WNZNHRMRXOXZHG-QABVFLJBSA-N. The full InChI is InChI=1S/C15H25N/c1-3-10-15(11-4-2)12-8-6-5-7-9-13-16-14-15/h6,8-9,13-14H,3-5,7,10-12H2,1-2H3/b8-6?,13-9?,16-14+.
What are the key properties of 9,9-dipropyl-5,8-dihydro-4H-azecine?
9,9-dipropyl-5,8-dihydro-4H-azecine has a molecular weight of 219.37 g/mol, XLogP of 4.90, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-dipropyl-5,8-dihydro-4H-azecine is sourced from PubChem (CID 70546472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).