About butyl 2-[1,3-bis(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]acetate
butyl 2-[1,3-bis(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]acetate (PubChem CID 70546540) has the molecular formula C21H18Cl2N2O4
and a molecular weight of 433.29 g/mol. Its IUPAC name is butyl 2-[1,3-bis(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]acetate.
Molecular Properties
| Compound Name | butyl 2-[1,3-bis(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]acetate |
| PubChem CID | 70546540 |
| Molecular Formula | C21H18Cl2N2O4 |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | butyl 2-[1,3-bis(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]acetate |
| SMILES | CCCCOC(=O)C=C1C(=O)N(c2ccc(Cl)cc2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18Cl2N2O4/c1-2-3-12-29-19(26)13-18-20(27)25(17-10-6-15(23)7-11-17)21(28)24(18)16-8-4-14(22)5-9-16/h4-11,13H,2-3,12H2,1H3 |
| InChIKey | QOENWNAZCWKZSC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-[1,3-bis(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-[1,3-bis(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]acetate?
The IUPAC name of butyl 2-[1,3-bis(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]acetate (CID 70546540) is butyl 2-[1,3-bis(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]acetate.
What is the SMILES notation for butyl 2-[1,3-bis(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]acetate?
The canonical SMILES for butyl 2-[1,3-bis(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]acetate is CCCCOC(=O)C=C1C(=O)N(c2ccc(Cl)cc2)C(=O)N1c1ccc(Cl)cc1.
What is the InChIKey of butyl 2-[1,3-bis(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]acetate?
The InChIKey is QOENWNAZCWKZSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18Cl2N2O4/c1-2-3-12-29-19(26)13-18-20(27)25(17-10-6-15(23)7-11-17)21(28)24(18)16-8-4-14(22)5-9-16/h4-11,13H,2-3,12H2,1H3.
What are the key properties of butyl 2-[1,3-bis(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]acetate?
butyl 2-[1,3-bis(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]acetate has a molecular weight of 433.29 g/mol, XLogP of 5.19, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-[1,3-bis(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]acetate is sourced from PubChem (CID 70546540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).