C13H16ClN3O2S — CID 70546912
2-(2-chloroethylsulfonyl)-1,4,5,6-tetrahydroperimidin-3a-amine (PubChem CID 70546912) has the molecular formula C13H16ClN3O2S and a molecular weight of 313.81 g/mol. Its IUPAC name is 2-(2-chloroethylsulfonyl)-1,4,5,6-tetrahydroperimidin-3a-amine.
| Compound Name | 2-(2-chloroethylsulfonyl)-1,4,5,6-tetrahydroperimidin-3a-amine |
|---|---|
| PubChem CID | 70546912 |
| Molecular Formula | C13H16ClN3O2S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-(2-chloroethylsulfonyl)-1,4,5,6-tetrahydroperimidin-3a-amine |
| SMILES | NC12CCCc3cccc(c31)NC(S(=O)(=O)CCCl)=N2 |
| InChI | InChI=1S/C13H16ClN3O2S/c14-7-8-20(18,19)12-16-10-5-1-3-9-4-2-6-13(15,17-12)11(9)10/h1,3,5H,2,4,6-8,15H2,(H,16,17) |
| InChIKey | RCHYQHQHKVXXRJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|