bis(3,4-dimethoxybenzoic acid);propane-1,2-diol

C21H28O10 — CID 70546989

IUPACbis(3,4-dimethoxybenzoic acid);propane-1,2-diol
SMILESCC(O)CO.COc1ccc(C(=O)O)cc1OC.COc1ccc(C(=O)O)cc1OC
InChIInChI=1S/2C9H10O4.C3H8O2/c2*1-12-7-4-3-6(9(10)11)5-8(7)13-2;1-3(5)2-4/h2*3-5H,1-2H3,(H,10,11);3-5H,2H2,1H3
InChIKeyZRQQJGGTBMERIU-UHFFFAOYSA-N
MW440.45 g/mol
LogP2.16
Rot. Bonds7

About bis(3,4-dimethoxybenzoic acid);propane-1,2-diol

bis(3,4-dimethoxybenzoic acid);propane-1,2-diol (PubChem CID 70546989) has the molecular formula C21H28O10 and a molecular weight of 440.45 g/mol. Its IUPAC name is bis(3,4-dimethoxybenzoic acid);propane-1,2-diol.

Molecular Properties

Compound Namebis(3,4-dimethoxybenzoic acid);propane-1,2-diol
PubChem CID70546989
Molecular FormulaC21H28O10
Molecular Weight440.45 g/mol
Exact Mass440.17
IUPAC Namebis(3,4-dimethoxybenzoic acid);propane-1,2-diol
SMILESCC(O)CO.COc1ccc(C(=O)O)cc1OC.COc1ccc(C(=O)O)cc1OC
InChIInChI=1S/2C9H10O4.C3H8O2/c2*1-12-7-4-3-6(9(10)11)5-8(7)13-2;1-3(5)2-4/h2*3-5H,1-2H3,(H,10,11);3-5H,2H2,1H3
InChIKeyZRQQJGGTBMERIU-UHFFFAOYSA-N
XLogP2.16
TPSA151.98 Ų
H-Bond Donors4
H-Bond Acceptors8
Rotatable Bonds7
Heavy Atoms31
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500440.45
LogP ≤ 52.16
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 108

Analyze bis(3,4-dimethoxybenzoic acid);propane-1,2-diol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bis(3,4-dimethoxybenzoic acid);propane-1,2-diol?
The IUPAC name of bis(3,4-dimethoxybenzoic acid);propane-1,2-diol (CID 70546989) is bis(3,4-dimethoxybenzoic acid);propane-1,2-diol.
What is the SMILES notation for bis(3,4-dimethoxybenzoic acid);propane-1,2-diol?
The canonical SMILES for bis(3,4-dimethoxybenzoic acid);propane-1,2-diol is CC(O)CO.COc1ccc(C(=O)O)cc1OC.COc1ccc(C(=O)O)cc1OC.
What is the InChIKey of bis(3,4-dimethoxybenzoic acid);propane-1,2-diol?
The InChIKey is ZRQQJGGTBMERIU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H10O4.C3H8O2/c2*1-12-7-4-3-6(9(10)11)5-8(7)13-2;1-3(5)2-4/h2*3-5H,1-2H3,(H,10,11);3-5H,2H2,1H3.
What are the key properties of bis(3,4-dimethoxybenzoic acid);propane-1,2-diol?
bis(3,4-dimethoxybenzoic acid);propane-1,2-diol has a molecular weight of 440.45 g/mol, XLogP of 2.16, 7 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3,4-dimethoxybenzoic acid);propane-1,2-diol is sourced from PubChem (CID 70546989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).