About 6H-benzo[c]chromene;hydrobromide
6H-benzo[c]chromene;hydrobromide (PubChem CID 70547533) has the molecular formula C13H11BrO
and a molecular weight of 263.13 g/mol. Its IUPAC name is 6H-benzo[c]chromene;hydrobromide.
Molecular Properties
| Compound Name | 6H-benzo[c]chromene;hydrobromide |
| PubChem CID | 70547533 |
| Molecular Formula | C13H11BrO |
| Molecular Weight | 263.13 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 6H-benzo[c]chromene;hydrobromide |
| SMILES | Br.c1ccc2c(c1)COc1ccccc1-2 |
| InChI | InChI=1S/C13H10O.BrH/c1-2-6-11-10(5-1)9-14-13-8-4-3-7-12(11)13;/h1-8H,9H2;1H |
| InChIKey | OKBAGWJXLUURGY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.13 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6H-benzo[c]chromene;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-benzo[c]chromene;hydrobromide?
The IUPAC name of 6H-benzo[c]chromene;hydrobromide (CID 70547533) is 6H-benzo[c]chromene;hydrobromide.
What is the SMILES notation for 6H-benzo[c]chromene;hydrobromide?
The canonical SMILES for 6H-benzo[c]chromene;hydrobromide is Br.c1ccc2c(c1)COc1ccccc1-2.
What is the InChIKey of 6H-benzo[c]chromene;hydrobromide?
The InChIKey is OKBAGWJXLUURGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.BrH/c1-2-6-11-10(5-1)9-14-13-8-4-3-7-12(11)13;/h1-8H,9H2;1H.
What are the key properties of 6H-benzo[c]chromene;hydrobromide?
6H-benzo[c]chromene;hydrobromide has a molecular weight of 263.13 g/mol, XLogP of 3.82, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-benzo[c]chromene;hydrobromide is sourced from PubChem (CID 70547533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).