C30H39NO4 — CID 70547732
4a-phenyl-2-[3-(2-propan-2-ylphenyl)propyl]-3,4,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridine;but-2-enedioic acid (PubChem CID 70547732) has the molecular formula C30H39NO4 and a molecular weight of 477.65 g/mol. Its IUPAC name is 4a-phenyl-2-[3-(2-propan-2-ylphenyl)propyl]-3,4,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridine;but-2-enedioic acid.
| Compound Name | 4a-phenyl-2-[3-(2-propan-2-ylphenyl)propyl]-3,4,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridine;but-2-enedioic acid |
|---|---|
| PubChem CID | 70547732 |
| Molecular Formula | C30H39NO4 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | 4a-phenyl-2-[3-(2-propan-2-ylphenyl)propyl]-3,4,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridine;but-2-enedioic acid |
| SMILES | CC(C)c1ccccc1CCCN1CCC2(c3ccccc3)CCCC2C1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C26H35N.C4H4O4/c1-21(2)25-15-7-6-10-22(25)11-9-18-27-19-17-26(16-8-14-24(26)20-27)23-12-4-3-5-13-23;5-3(6)1-2-4(7)8/h3-7,10,12-13,15,21,24H,8-9,11,14,16-20H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | FQFZHSLJBQJWDN-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|