About CID 70548130
CID 70548130 (PubChem CID 70548130) has the molecular formula C23H35SSn
and a molecular weight of 462.31 g/mol.
Molecular Properties
| Compound Name | CID 70548130 |
| PubChem CID | 70548130 |
| Molecular Formula | C23H35SSn |
| Molecular Weight | 462.31 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | — |
| SMILES | CCC[Sn](CCC)CCC.Cc1ccc(Sc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C14H14S.3C3H7.Sn/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14;3*1-3-2;/h3-10H,1-2H3;3*1,3H2,2H3; |
| InChIKey | TYMNSQVQUWSHIP-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.31 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 70548130 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70548130?
The IUPAC name of CID 70548130 (CID 70548130) is not available.
What is the SMILES notation for CID 70548130?
The canonical SMILES for CID 70548130 is CCC[Sn](CCC)CCC.Cc1ccc(Sc2ccc(C)cc2)cc1.
What is the InChIKey of CID 70548130?
The InChIKey is TYMNSQVQUWSHIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14S.3C3H7.Sn/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14;3*1-3-2;/h3-10H,1-2H3;3*1,3H2,2H3;.
What are the key properties of CID 70548130?
CID 70548130 has a molecular weight of 462.31 g/mol, XLogP of 8.17, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70548130 is sourced from PubChem (CID 70548130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).