About (3-methyl-3-propan-2-ylcyclohexyl) prop-2-enyl carbonate
(3-methyl-3-propan-2-ylcyclohexyl) prop-2-enyl carbonate (PubChem CID 70548357) has the molecular formula C14H24O3
and a molecular weight of 240.34 g/mol. Its IUPAC name is (3-methyl-3-propan-2-ylcyclohexyl) prop-2-enyl carbonate.
Molecular Properties
| Compound Name | (3-methyl-3-propan-2-ylcyclohexyl) prop-2-enyl carbonate |
| PubChem CID | 70548357 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (3-methyl-3-propan-2-ylcyclohexyl) prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)OC1CCCC(C)(C(C)C)C1 |
| InChI | InChI=1S/C14H24O3/c1-5-9-16-13(15)17-12-7-6-8-14(4,10-12)11(2)3/h5,11-12H,1,6-10H2,2-4H3 |
| InChIKey | XOTRWNTZAMCKKQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-3-propan-2-ylcyclohexyl) prop-2-enyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-3-propan-2-ylcyclohexyl) prop-2-enyl carbonate?
The IUPAC name of (3-methyl-3-propan-2-ylcyclohexyl) prop-2-enyl carbonate (CID 70548357) is (3-methyl-3-propan-2-ylcyclohexyl) prop-2-enyl carbonate.
What is the SMILES notation for (3-methyl-3-propan-2-ylcyclohexyl) prop-2-enyl carbonate?
The canonical SMILES for (3-methyl-3-propan-2-ylcyclohexyl) prop-2-enyl carbonate is C=CCOC(=O)OC1CCCC(C)(C(C)C)C1.
What is the InChIKey of (3-methyl-3-propan-2-ylcyclohexyl) prop-2-enyl carbonate?
The InChIKey is XOTRWNTZAMCKKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O3/c1-5-9-16-13(15)17-12-7-6-8-14(4,10-12)11(2)3/h5,11-12H,1,6-10H2,2-4H3.
What are the key properties of (3-methyl-3-propan-2-ylcyclohexyl) prop-2-enyl carbonate?
(3-methyl-3-propan-2-ylcyclohexyl) prop-2-enyl carbonate has a molecular weight of 240.34 g/mol, XLogP of 3.93, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-3-propan-2-ylcyclohexyl) prop-2-enyl carbonate is sourced from PubChem (CID 70548357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).