2-methyloxolan-3-ol;silicic acid

C5H14O6Si — CID 70548601

IUPAC2-methyloxolan-3-ol;silicic acid
SMILESCC1OCCC1O.O[Si](O)(O)O
InChIInChI=1S/C5H10O2.H4O4Si/c1-4-5(6)2-3-7-4;1-5(2,3)4/h4-6H,2-3H2,1H3;1-4H
InChIKeyLGZQZOODUWZYES-UHFFFAOYSA-N
MW198.25 g/mol
LogP-2.45
Rot. Bonds

About 2-methyloxolan-3-ol;silicic acid

2-methyloxolan-3-ol;silicic acid (PubChem CID 70548601) has the molecular formula C5H14O6Si and a molecular weight of 198.25 g/mol. Its IUPAC name is 2-methyloxolan-3-ol;silicic acid.

Molecular Properties

Compound Name2-methyloxolan-3-ol;silicic acid
PubChem CID70548601
Molecular FormulaC5H14O6Si
Molecular Weight198.25 g/mol
Exact Mass198.06
IUPAC Name2-methyloxolan-3-ol;silicic acid
SMILESCC1OCCC1O.O[Si](O)(O)O
InChIInChI=1S/C5H10O2.H4O4Si/c1-4-5(6)2-3-7-4;1-5(2,3)4/h4-6H,2-3H2,1H3;1-4H
InChIKeyLGZQZOODUWZYES-UHFFFAOYSA-N
XLogP-2.45
TPSA110.38 Ų
H-Bond Donors5
H-Bond Acceptors6
Rotatable Bonds
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.25
LogP ≤ 5-2.45
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 2-methyloxolan-3-ol;silicic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyloxolan-3-ol;silicic acid?
The IUPAC name of 2-methyloxolan-3-ol;silicic acid (CID 70548601) is 2-methyloxolan-3-ol;silicic acid.
What is the SMILES notation for 2-methyloxolan-3-ol;silicic acid?
The canonical SMILES for 2-methyloxolan-3-ol;silicic acid is CC1OCCC1O.O[Si](O)(O)O.
What is the InChIKey of 2-methyloxolan-3-ol;silicic acid?
The InChIKey is LGZQZOODUWZYES-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.H4O4Si/c1-4-5(6)2-3-7-4;1-5(2,3)4/h4-6H,2-3H2,1H3;1-4H.
What are the key properties of 2-methyloxolan-3-ol;silicic acid?
2-methyloxolan-3-ol;silicic acid has a molecular weight of 198.25 g/mol, XLogP of -2.45, 0 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyloxolan-3-ol;silicic acid is sourced from PubChem (CID 70548601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).