C28H43NO5 — CID 70549006
3-[(2-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]-N,N-diethylpropan-1-amine;(E)-but-2-enedioic acid (PubChem CID 70549006) has the molecular formula C28H43NO5 and a molecular weight of 473.65 g/mol. Its IUPAC name is 3-[(2-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]-N,N-diethylpropan-1-amine;(E)-but-2-enedioic acid.
| Compound Name | 3-[(2-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]-N,N-diethylpropan-1-amine;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 70549006 |
| Molecular Formula | C28H43NO5 |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.31 |
| IUPAC Name | 3-[(2-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]-N,N-diethylpropan-1-amine;(E)-but-2-enedioic acid |
| SMILES | CCN(CC)CCCOC1(Cc2ccccc2)CC2CCC1(C)C2(C)C.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C24H39NO.C4H4O4/c1-6-25(7-2)16-11-17-26-24(18-20-12-9-8-10-13-20)19-21-14-15-23(24,5)22(21,3)4;5-3(6)1-2-4(7)8/h8-10,12-13,21H,6-7,11,14-19H2,1-5H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | BINZVXYKHSPESJ-WLHGVMLRSA-N |
| XLogP | 5.27 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|