C25H28ClNO9 — CID 70549059
[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate (PubChem CID 70549059) has the molecular formula C25H28ClNO9 and a molecular weight of 521.95 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate.
| Compound Name | [(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
|---|---|
| PubChem CID | 70549059 |
| Molecular Formula | C25H28ClNO9 |
| Molecular Weight | 521.95 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | [(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
| SMILES | COc1ccc2c(c1)c(CC(=O)OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H28ClNO9/c1-13-17(10-22(31)36-12-21(30)24(33)23(32)20(29)11-28)18-9-16(35-2)7-8-19(18)27(13)25(34)14-3-5-15(26)6-4-14/h3-9,20-21,23-24,28-30,32-33H,10-12H2,1-2H3/t20-,21-,23-,24-/m1/s1 |
| InChIKey | MOOOBKPAADXBHG-LUGTWXOSSA-N |
| XLogP | 0.82 |
| TPSA | 158.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.95 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |