C18H17ClN2O5 — CID 70549128
but-2-enedioic acid;(3-chloro-5,6-dihydrobenzo[b][1,4]benzoxazepin-6-yl)methanamine (PubChem CID 70549128) has the molecular formula C18H17ClN2O5 and a molecular weight of 376.80 g/mol. Its IUPAC name is but-2-enedioic acid;(3-chloro-5,6-dihydrobenzo[b][1,4]benzoxazepin-6-yl)methanamine.
| Compound Name | but-2-enedioic acid;(3-chloro-5,6-dihydrobenzo[b][1,4]benzoxazepin-6-yl)methanamine |
|---|---|
| PubChem CID | 70549128 |
| Molecular Formula | C18H17ClN2O5 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | but-2-enedioic acid;(3-chloro-5,6-dihydrobenzo[b][1,4]benzoxazepin-6-yl)methanamine |
| SMILES | NCC1Nc2cc(Cl)ccc2Oc2ccccc21.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C14H13ClN2O.C4H4O4/c15-9-5-6-14-11(7-9)17-12(8-16)10-3-1-2-4-13(10)18-14;5-3(6)1-2-4(7)8/h1-7,12,17H,8,16H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | KGBJGJSRNHBXCS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|