About 1-methylimidazo[1,5-a][1,4]benzodiazepin-6-one
1-methylimidazo[1,5-a][1,4]benzodiazepin-6-one (PubChem CID 70549517) has the molecular formula C12H9N3O
and a molecular weight of 211.22 g/mol. Its IUPAC name is 1-methylimidazo[1,5-a][1,4]benzodiazepin-6-one.
Molecular Properties
| Compound Name | 1-methylimidazo[1,5-a][1,4]benzodiazepin-6-one |
| PubChem CID | 70549517 |
| Molecular Formula | C12H9N3O |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 1-methylimidazo[1,5-a][1,4]benzodiazepin-6-one |
| SMILES | Cc1ncc2cnc(=O)c3ccccc3n12 |
| InChI | InChI=1S/C12H9N3O/c1-8-13-6-9-7-14-12(16)10-4-2-3-5-11(10)15(8)9/h2-7H,1H3 |
| InChIKey | ZKFDDUYJLKAQAW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methylimidazo[1,5-a][1,4]benzodiazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylimidazo[1,5-a][1,4]benzodiazepin-6-one?
The IUPAC name of 1-methylimidazo[1,5-a][1,4]benzodiazepin-6-one (CID 70549517) is 1-methylimidazo[1,5-a][1,4]benzodiazepin-6-one.
What is the SMILES notation for 1-methylimidazo[1,5-a][1,4]benzodiazepin-6-one?
The canonical SMILES for 1-methylimidazo[1,5-a][1,4]benzodiazepin-6-one is Cc1ncc2cnc(=O)c3ccccc3n12.
What is the InChIKey of 1-methylimidazo[1,5-a][1,4]benzodiazepin-6-one?
The InChIKey is ZKFDDUYJLKAQAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O/c1-8-13-6-9-7-14-12(16)10-4-2-3-5-11(10)15(8)9/h2-7H,1H3.
What are the key properties of 1-methylimidazo[1,5-a][1,4]benzodiazepin-6-one?
1-methylimidazo[1,5-a][1,4]benzodiazepin-6-one has a molecular weight of 211.22 g/mol, XLogP of 1.55, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylimidazo[1,5-a][1,4]benzodiazepin-6-one is sourced from PubChem (CID 70549517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).