C25H36N4O2 — CID 70549733
N-[[1-amino-5-[3-(piperidin-1-ylmethyl)phenoxy]pentylidene]amino]acetamide;benzene (PubChem CID 70549733) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is N-[[1-amino-5-[3-(piperidin-1-ylmethyl)phenoxy]pentylidene]amino]acetamide;benzene.
| Compound Name | N-[[1-amino-5-[3-(piperidin-1-ylmethyl)phenoxy]pentylidene]amino]acetamide;benzene |
|---|---|
| PubChem CID | 70549733 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | N-[[1-amino-5-[3-(piperidin-1-ylmethyl)phenoxy]pentylidene]amino]acetamide;benzene |
| SMILES | CC(=O)NN=C(N)CCCCOc1cccc(CN2CCCCC2)c1.c1ccccc1 |
| InChI | InChI=1S/C19H30N4O2.C6H6/c1-16(24)21-22-19(20)10-3-6-13-25-18-9-7-8-17(14-18)15-23-11-4-2-5-12-23;1-2-4-6-5-3-1/h7-9,14H,2-6,10-13,15H2,1H3,(H2,20,22)(H,21,24);1-6H |
| InChIKey | NXSDDJBHPFZXEH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|