About 2,6-ditert-butyl-4-[(2,6-ditert-butyl-2H-thiopyran-4-yl)methylidene]thiopyran
2,6-ditert-butyl-4-[(2,6-ditert-butyl-2H-thiopyran-4-yl)methylidene]thiopyran (PubChem CID 70550395) has the molecular formula C27H42S2
and a molecular weight of 430.77 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(2,6-ditert-butyl-2H-thiopyran-4-yl)methylidene]thiopyran.
Molecular Properties
| Compound Name | 2,6-ditert-butyl-4-[(2,6-ditert-butyl-2H-thiopyran-4-yl)methylidene]thiopyran |
| PubChem CID | 70550395 |
| Molecular Formula | C27H42S2 |
| Molecular Weight | 430.77 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 2,6-ditert-butyl-4-[(2,6-ditert-butyl-2H-thiopyran-4-yl)methylidene]thiopyran |
| SMILES | CC(C)(C)C1=CC(=CC2=CC(C(C)(C)C)SC(C(C)(C)C)=C2)C=C(C(C)(C)C)S1 |
| InChI | InChI=1S/C27H42S2/c1-24(2,3)20-14-18(15-21(28-20)25(4,5)6)13-19-16-22(26(7,8)9)29-23(17-19)27(10,11)12/h13-17,20H,1-12H3 |
| InChIKey | JQWUCQKFLJQUMR-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.77 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-ditert-butyl-4-[(2,6-ditert-butyl-2H-thiopyran-4-yl)methylidene]thiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-ditert-butyl-4-[(2,6-ditert-butyl-2H-thiopyran-4-yl)methylidene]thiopyran?
The IUPAC name of 2,6-ditert-butyl-4-[(2,6-ditert-butyl-2H-thiopyran-4-yl)methylidene]thiopyran (CID 70550395) is 2,6-ditert-butyl-4-[(2,6-ditert-butyl-2H-thiopyran-4-yl)methylidene]thiopyran.
What is the SMILES notation for 2,6-ditert-butyl-4-[(2,6-ditert-butyl-2H-thiopyran-4-yl)methylidene]thiopyran?
The canonical SMILES for 2,6-ditert-butyl-4-[(2,6-ditert-butyl-2H-thiopyran-4-yl)methylidene]thiopyran is CC(C)(C)C1=CC(=CC2=CC(C(C)(C)C)SC(C(C)(C)C)=C2)C=C(C(C)(C)C)S1.
What is the InChIKey of 2,6-ditert-butyl-4-[(2,6-ditert-butyl-2H-thiopyran-4-yl)methylidene]thiopyran?
The InChIKey is JQWUCQKFLJQUMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H42S2/c1-24(2,3)20-14-18(15-21(28-20)25(4,5)6)13-19-16-22(26(7,8)9)29-23(17-19)27(10,11)12/h13-17,20H,1-12H3.
What are the key properties of 2,6-ditert-butyl-4-[(2,6-ditert-butyl-2H-thiopyran-4-yl)methylidene]thiopyran?
2,6-ditert-butyl-4-[(2,6-ditert-butyl-2H-thiopyran-4-yl)methylidene]thiopyran has a molecular weight of 430.77 g/mol, XLogP of 9.54, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-ditert-butyl-4-[(2,6-ditert-butyl-2H-thiopyran-4-yl)methylidene]thiopyran is sourced from PubChem (CID 70550395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).