About (2S)-2-[[6,7-di(propanoyloxy)naphthalen-1-yl]amino]propanoic acid;hydrochloride
(2S)-2-[[6,7-di(propanoyloxy)naphthalen-1-yl]amino]propanoic acid;hydrochloride (PubChem CID 70550439) has the molecular formula C19H22ClNO6
and a molecular weight of 395.84 g/mol. Its IUPAC name is (2S)-2-[[6,7-di(propanoyloxy)naphthalen-1-yl]amino]propanoic acid;hydrochloride.
Molecular Properties
| Compound Name | (2S)-2-[[6,7-di(propanoyloxy)naphthalen-1-yl]amino]propanoic acid;hydrochloride |
| PubChem CID | 70550439 |
| Molecular Formula | C19H22ClNO6 |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (2S)-2-[[6,7-di(propanoyloxy)naphthalen-1-yl]amino]propanoic acid;hydrochloride |
| SMILES | CCC(=O)Oc1cc2cccc(N[C@@H](C)C(=O)O)c2cc1OC(=O)CC.Cl |
| InChI | InChI=1S/C19H21NO6.ClH/c1-4-17(21)25-15-9-12-7-6-8-14(20-11(3)19(23)24)13(12)10-16(15)26-18(22)5-2;/h6-11,20H,4-5H2,1-3H3,(H,23,24);1H/t11-;/m0./s1 |
| InChIKey | HZRZIRLINXQTQB-MERQFXBCSA-N |
| XLogP | 3.78 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[[6,7-di(propanoyloxy)naphthalen-1-yl]amino]propanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[6,7-di(propanoyloxy)naphthalen-1-yl]amino]propanoic acid;hydrochloride?
The IUPAC name of (2S)-2-[[6,7-di(propanoyloxy)naphthalen-1-yl]amino]propanoic acid;hydrochloride (CID 70550439) is (2S)-2-[[6,7-di(propanoyloxy)naphthalen-1-yl]amino]propanoic acid;hydrochloride.
What is the SMILES notation for (2S)-2-[[6,7-di(propanoyloxy)naphthalen-1-yl]amino]propanoic acid;hydrochloride?
The canonical SMILES for (2S)-2-[[6,7-di(propanoyloxy)naphthalen-1-yl]amino]propanoic acid;hydrochloride is CCC(=O)Oc1cc2cccc(N[C@@H](C)C(=O)O)c2cc1OC(=O)CC.Cl.
What is the InChIKey of (2S)-2-[[6,7-di(propanoyloxy)naphthalen-1-yl]amino]propanoic acid;hydrochloride?
The InChIKey is HZRZIRLINXQTQB-MERQFXBCSA-N. The full InChI is InChI=1S/C19H21NO6.ClH/c1-4-17(21)25-15-9-12-7-6-8-14(20-11(3)19(23)24)13(12)10-16(15)26-18(22)5-2;/h6-11,20H,4-5H2,1-3H3,(H,23,24);1H/t11-;/m0./s1.
What are the key properties of (2S)-2-[[6,7-di(propanoyloxy)naphthalen-1-yl]amino]propanoic acid;hydrochloride?
(2S)-2-[[6,7-di(propanoyloxy)naphthalen-1-yl]amino]propanoic acid;hydrochloride has a molecular weight of 395.84 g/mol, XLogP of 3.78, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[6,7-di(propanoyloxy)naphthalen-1-yl]amino]propanoic acid;hydrochloride is sourced from PubChem (CID 70550439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).