C15H22N2O4 — CID 70550465
(5aS,8aS)-3,4,4a,5,5a,6,7,8,8a,9-decahydro-2H-pyrrolo[3,4-g]quinoline;(Z)-but-2-enedioic acid (PubChem CID 70550465) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is (5aS,8aS)-3,4,4a,5,5a,6,7,8,8a,9-decahydro-2H-pyrrolo[3,4-g]quinoline;(Z)-but-2-enedioic acid.
| Compound Name | (5aS,8aS)-3,4,4a,5,5a,6,7,8,8a,9-decahydro-2H-pyrrolo[3,4-g]quinoline;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 70550465 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (5aS,8aS)-3,4,4a,5,5a,6,7,8,8a,9-decahydro-2H-pyrrolo[3,4-g]quinoline;(Z)-but-2-enedioic acid |
| SMILES | C1CN=C2C[C@@H]3CNC[C@H]3CC2C1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C11H18N2.C4H4O4/c1-2-8-4-9-6-12-7-10(9)5-11(8)13-3-1;5-3(6)1-2-4(7)8/h8-10,12H,1-7H2;1-2H,(H,5,6)(H,7,8)/b;2-1-/t8?,9-,10-;/m1./s1 |
| InChIKey | GESCFLRMUYPTBU-NPQNTIIGSA-N |
| XLogP | 1.18 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|