About [3-acetyloxy-6-(2-aminoethyl)-4-methylnaphthalen-2-yl] acetate;hydrochloride
[3-acetyloxy-6-(2-aminoethyl)-4-methylnaphthalen-2-yl] acetate;hydrochloride (PubChem CID 70550498) has the molecular formula C17H20ClNO4
and a molecular weight of 337.80 g/mol. Its IUPAC name is [3-acetyloxy-6-(2-aminoethyl)-4-methylnaphthalen-2-yl] acetate;hydrochloride.
Molecular Properties
| Compound Name | [3-acetyloxy-6-(2-aminoethyl)-4-methylnaphthalen-2-yl] acetate;hydrochloride |
| PubChem CID | 70550498 |
| Molecular Formula | C17H20ClNO4 |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | [3-acetyloxy-6-(2-aminoethyl)-4-methylnaphthalen-2-yl] acetate;hydrochloride |
| SMILES | CC(=O)Oc1cc2ccc(CCN)cc2c(C)c1OC(C)=O.Cl |
| InChI | InChI=1S/C17H19NO4.ClH/c1-10-15-8-13(6-7-18)4-5-14(15)9-16(21-11(2)19)17(10)22-12(3)20;/h4-5,8-9H,6-7,18H2,1-3H3;1H |
| InChIKey | DLBHDXHGWSQAHY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-acetyloxy-6-(2-aminoethyl)-4-methylnaphthalen-2-yl] acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-acetyloxy-6-(2-aminoethyl)-4-methylnaphthalen-2-yl] acetate;hydrochloride?
The IUPAC name of [3-acetyloxy-6-(2-aminoethyl)-4-methylnaphthalen-2-yl] acetate;hydrochloride (CID 70550498) is [3-acetyloxy-6-(2-aminoethyl)-4-methylnaphthalen-2-yl] acetate;hydrochloride.
What is the SMILES notation for [3-acetyloxy-6-(2-aminoethyl)-4-methylnaphthalen-2-yl] acetate;hydrochloride?
The canonical SMILES for [3-acetyloxy-6-(2-aminoethyl)-4-methylnaphthalen-2-yl] acetate;hydrochloride is CC(=O)Oc1cc2ccc(CCN)cc2c(C)c1OC(C)=O.Cl.
What is the InChIKey of [3-acetyloxy-6-(2-aminoethyl)-4-methylnaphthalen-2-yl] acetate;hydrochloride?
The InChIKey is DLBHDXHGWSQAHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO4.ClH/c1-10-15-8-13(6-7-18)4-5-14(15)9-16(21-11(2)19)17(10)22-12(3)20;/h4-5,8-9H,6-7,18H2,1-3H3;1H.
What are the key properties of [3-acetyloxy-6-(2-aminoethyl)-4-methylnaphthalen-2-yl] acetate;hydrochloride?
[3-acetyloxy-6-(2-aminoethyl)-4-methylnaphthalen-2-yl] acetate;hydrochloride has a molecular weight of 337.80 g/mol, XLogP of 2.92, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-acetyloxy-6-(2-aminoethyl)-4-methylnaphthalen-2-yl] acetate;hydrochloride is sourced from PubChem (CID 70550498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).