C9H15NO — CID 7055065
(9aS)-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one (PubChem CID 7055065) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (9aS)-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one.
| Compound Name | (9aS)-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one |
|---|---|
| PubChem CID | 7055065 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (9aS)-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one |
| SMILES | O=C1CCN2CCCC[C@H]2C1 |
| InChI | InChI=1S/C9H15NO/c11-9-4-6-10-5-2-1-3-8(10)7-9/h8H,1-7H2/t8-/m0/s1 |
| InChIKey | RRPGLCASKVWATQ-QMMMGPOBSA-N |
| XLogP | 1.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |