C13H27N3O4S — CID 70550668
acetic acid;4-[2-[cyclopropylsulfamoyl(methyl)amino]ethyl]piperidine (PubChem CID 70550668) has the molecular formula C13H27N3O4S and a molecular weight of 321.44 g/mol. Its IUPAC name is acetic acid;4-[2-[cyclopropylsulfamoyl(methyl)amino]ethyl]piperidine.
| Compound Name | acetic acid;4-[2-[cyclopropylsulfamoyl(methyl)amino]ethyl]piperidine |
|---|---|
| PubChem CID | 70550668 |
| Molecular Formula | C13H27N3O4S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | acetic acid;4-[2-[cyclopropylsulfamoyl(methyl)amino]ethyl]piperidine |
| SMILES | CC(=O)O.CN(CCC1CCNCC1)S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C11H23N3O2S.C2H4O2/c1-14(17(15,16)13-11-2-3-11)9-6-10-4-7-12-8-5-10;1-2(3)4/h10-13H,2-9H2,1H3;1H3,(H,3,4) |
| InChIKey | WQFWHIAITHRRRE-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |