C18H24ClNO2 — CID 70550884
(1S,9R,10R,12S)-4-methoxy-12-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one;hydrochloride (PubChem CID 70550884) has the molecular formula C18H24ClNO2 and a molecular weight of 321.85 g/mol. Its IUPAC name is (1S,9R,10R,12S)-4-methoxy-12-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one;hydrochloride.
| Compound Name | (1S,9R,10R,12S)-4-methoxy-12-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one;hydrochloride |
|---|---|
| PubChem CID | 70550884 |
| Molecular Formula | C18H24ClNO2 |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (1S,9R,10R,12S)-4-methoxy-12-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one;hydrochloride |
| SMILES | COc1ccc2c(c1)[C@]13CCN[C@H](C2)[C@@H]1C[C@H](C)C(=O)C3.Cl |
| InChI | InChI=1S/C18H23NO2.ClH/c1-11-7-15-16-8-12-3-4-13(21-2)9-14(12)18(15,5-6-19-16)10-17(11)20;/h3-4,9,11,15-16,19H,5-8,10H2,1-2H3;1H/t11-,15-,16+,18+;/m0./s1 |
| InChIKey | AKOVJGSTOWNGCL-BJLGAWORSA-N |
| XLogP | 2.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |