C18H20NO4+ — CID 7055119
5,13-dimethoxy-9-azoniatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),3,5,11(16),12,14-hexaene-6,12-diol (PubChem CID 7055119) has the molecular formula C18H20NO4+ and a molecular weight of 314.36 g/mol. Its IUPAC name is 5,13-dimethoxy-9-azoniatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),3,5,11(16),12,14-hexaene-6,12-diol.
| Compound Name | 5,13-dimethoxy-9-azoniatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),3,5,11(16),12,14-hexaene-6,12-diol |
|---|---|
| PubChem CID | 7055119 |
| Molecular Formula | C18H20NO4+ |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 5,13-dimethoxy-9-azoniatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),3,5,11(16),12,14-hexaene-6,12-diol |
| SMILES | COc1ccc2c(c1O)C[NH+]1Cc3c(ccc(OC)c3O)C2C1 |
| InChI | InChI=1S/C18H19NO4/c1-22-15-5-3-10-12-7-19(8-13(10)17(15)20)9-14-11(12)4-6-16(23-2)18(14)21/h3-6,12,20-21H,7-9H2,1-2H3/p+1 |
| InChIKey | LTAZCBIGUQFXHA-UHFFFAOYSA-O |
| XLogP | 1.16 |
| TPSA | 63.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|