C20H20N2O6 — CID 70551508
6-butyl-1,7-dimethyl-4,10-dioxo-1,7-phenanthroline-2,8-dicarboxylic acid (PubChem CID 70551508) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is 6-butyl-1,7-dimethyl-4,10-dioxo-1,7-phenanthroline-2,8-dicarboxylic acid.
| Compound Name | 6-butyl-1,7-dimethyl-4,10-dioxo-1,7-phenanthroline-2,8-dicarboxylic acid |
|---|---|
| PubChem CID | 70551508 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 6-butyl-1,7-dimethyl-4,10-dioxo-1,7-phenanthroline-2,8-dicarboxylic acid |
| SMILES | CCCCc1cc2c(=O)cc(C(=O)O)n(C)c2c2c(=O)cc(C(=O)O)n(C)c12 |
| InChI | InChI=1S/C20H20N2O6/c1-4-5-6-10-7-11-14(23)8-12(19(25)26)22(3)18(11)16-15(24)9-13(20(27)28)21(2)17(10)16/h7-9H,4-6H2,1-3H3,(H,25,26)(H,27,28) |
| InChIKey | LRLDPMYYEJUTOC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|