C28H52N2O5 — CID 70551594
7,7,9,9-tetramethyl-8-[3-[3-(7,7,9,9-tetramethyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propoxy]propyl]-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 70551594) has the molecular formula C28H52N2O5 and a molecular weight of 496.73 g/mol. Its IUPAC name is 7,7,9,9-tetramethyl-8-[3-[3-(7,7,9,9-tetramethyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propoxy]propyl]-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 7,7,9,9-tetramethyl-8-[3-[3-(7,7,9,9-tetramethyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propoxy]propyl]-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 70551594 |
| Molecular Formula | C28H52N2O5 |
| Molecular Weight | 496.73 g/mol |
| Exact Mass | 496.39 |
| IUPAC Name | 7,7,9,9-tetramethyl-8-[3-[3-(7,7,9,9-tetramethyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propoxy]propyl]-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | CC1(C)CC2(CC(C)(C)N1CCCOCCCN1C(C)(C)CC3(CC1(C)C)OCCO3)OCCO2 |
| InChI | InChI=1S/C28H52N2O5/c1-23(2)19-27(32-15-16-33-27)20-24(3,4)29(23)11-9-13-31-14-10-12-30-25(5,6)21-28(22-26(30,7)8)34-17-18-35-28/h9-22H2,1-8H3 |
| InChIKey | UEQSSBKJLUXTLF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 52.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.73 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|