C14H18O — CID 70551647
1,2,3,4,4a,4b,5,6-octahydrophenanthren-9-ol (PubChem CID 70551647) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 1,2,3,4,4a,4b,5,6-octahydrophenanthren-9-ol.
| Compound Name | 1,2,3,4,4a,4b,5,6-octahydrophenanthren-9-ol |
|---|---|
| PubChem CID | 70551647 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 1,2,3,4,4a,4b,5,6-octahydrophenanthren-9-ol |
| SMILES | OC1=C2C=CCCC2C2CCCCC2=C1 |
| InChI | InChI=1S/C14H18O/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h4,8-9,11-12,15H,1-3,5-7H2 |
| InChIKey | COZPDIQGKFQSHY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |