About 3-(4,5-dihydro-1H-imidazol-2-yl)-4H-pyrimidin-4-amine
3-(4,5-dihydro-1H-imidazol-2-yl)-4H-pyrimidin-4-amine (PubChem CID 70552143) has the molecular formula C7H11N5
and a molecular weight of 165.20 g/mol. Its IUPAC name is 3-(4,5-dihydro-1H-imidazol-2-yl)-4H-pyrimidin-4-amine.
Molecular Properties
| Compound Name | 3-(4,5-dihydro-1H-imidazol-2-yl)-4H-pyrimidin-4-amine |
| PubChem CID | 70552143 |
| Molecular Formula | C7H11N5 |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 3-(4,5-dihydro-1H-imidazol-2-yl)-4H-pyrimidin-4-amine |
| SMILES | NC1C=CN=CN1C1=NCCN1 |
| InChI | InChI=1S/C7H11N5/c8-6-1-2-9-5-12(6)7-10-3-4-11-7/h1-2,5-6H,3-4,8H2,(H,10,11) |
| InChIKey | WGFBUQZOQINPPY-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4,5-dihydro-1H-imidazol-2-yl)-4H-pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dihydro-1H-imidazol-2-yl)-4H-pyrimidin-4-amine?
The IUPAC name of 3-(4,5-dihydro-1H-imidazol-2-yl)-4H-pyrimidin-4-amine (CID 70552143) is 3-(4,5-dihydro-1H-imidazol-2-yl)-4H-pyrimidin-4-amine.
What is the SMILES notation for 3-(4,5-dihydro-1H-imidazol-2-yl)-4H-pyrimidin-4-amine?
The canonical SMILES for 3-(4,5-dihydro-1H-imidazol-2-yl)-4H-pyrimidin-4-amine is NC1C=CN=CN1C1=NCCN1.
What is the InChIKey of 3-(4,5-dihydro-1H-imidazol-2-yl)-4H-pyrimidin-4-amine?
The InChIKey is WGFBUQZOQINPPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N5/c8-6-1-2-9-5-12(6)7-10-3-4-11-7/h1-2,5-6H,3-4,8H2,(H,10,11).
What are the key properties of 3-(4,5-dihydro-1H-imidazol-2-yl)-4H-pyrimidin-4-amine?
3-(4,5-dihydro-1H-imidazol-2-yl)-4H-pyrimidin-4-amine has a molecular weight of 165.20 g/mol, XLogP of -0.91, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dihydro-1H-imidazol-2-yl)-4H-pyrimidin-4-amine is sourced from PubChem (CID 70552143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).