About 2-(benzenesulfonyl)-6,7-dichloroquinoxaline
2-(benzenesulfonyl)-6,7-dichloroquinoxaline (PubChem CID 70552660) has the molecular formula C14H8Cl2N2O2S
and a molecular weight of 339.20 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-6,7-dichloroquinoxaline.
Molecular Properties
| Compound Name | 2-(benzenesulfonyl)-6,7-dichloroquinoxaline |
| PubChem CID | 70552660 |
| Molecular Formula | C14H8Cl2N2O2S |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | 2-(benzenesulfonyl)-6,7-dichloroquinoxaline |
| SMILES | O=S(=O)(c1ccccc1)c1cnc2cc(Cl)c(Cl)cc2n1 |
| InChI | InChI=1S/C14H8Cl2N2O2S/c15-10-6-12-13(7-11(10)16)18-14(8-17-12)21(19,20)9-4-2-1-3-5-9/h1-8H |
| InChIKey | JKJXRRMQUVVWBD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(benzenesulfonyl)-6,7-dichloroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyl)-6,7-dichloroquinoxaline?
The IUPAC name of 2-(benzenesulfonyl)-6,7-dichloroquinoxaline (CID 70552660) is 2-(benzenesulfonyl)-6,7-dichloroquinoxaline.
What is the SMILES notation for 2-(benzenesulfonyl)-6,7-dichloroquinoxaline?
The canonical SMILES for 2-(benzenesulfonyl)-6,7-dichloroquinoxaline is O=S(=O)(c1ccccc1)c1cnc2cc(Cl)c(Cl)cc2n1.
What is the InChIKey of 2-(benzenesulfonyl)-6,7-dichloroquinoxaline?
The InChIKey is JKJXRRMQUVVWBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl2N2O2S/c15-10-6-12-13(7-11(10)16)18-14(8-17-12)21(19,20)9-4-2-1-3-5-9/h1-8H.
What are the key properties of 2-(benzenesulfonyl)-6,7-dichloroquinoxaline?
2-(benzenesulfonyl)-6,7-dichloroquinoxaline has a molecular weight of 339.20 g/mol, XLogP of 3.77, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyl)-6,7-dichloroquinoxaline is sourced from PubChem (CID 70552660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).