About pyridine-2,3-diamine;pyridine-3,5-diamine
pyridine-2,3-diamine;pyridine-3,5-diamine (PubChem CID 70552694) has the molecular formula C10H14N6
and a molecular weight of 218.26 g/mol. Its IUPAC name is pyridine-2,3-diamine;pyridine-3,5-diamine.
Molecular Properties
| Compound Name | pyridine-2,3-diamine;pyridine-3,5-diamine |
| PubChem CID | 70552694 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | pyridine-2,3-diamine;pyridine-3,5-diamine |
| SMILES | Nc1cccnc1N.Nc1cncc(N)c1 |
| InChI | InChI=1S/2C5H7N3/c6-4-1-5(7)3-8-2-4;6-4-2-1-3-8-5(4)7/h1-3H,6-7H2;1-3H,6H2,(H2,7,8) |
| InChIKey | GDJMBJUAURGFGV-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 129.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze pyridine-2,3-diamine;pyridine-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-2,3-diamine;pyridine-3,5-diamine?
The IUPAC name of pyridine-2,3-diamine;pyridine-3,5-diamine (CID 70552694) is pyridine-2,3-diamine;pyridine-3,5-diamine.
What is the SMILES notation for pyridine-2,3-diamine;pyridine-3,5-diamine?
The canonical SMILES for pyridine-2,3-diamine;pyridine-3,5-diamine is Nc1cccnc1N.Nc1cncc(N)c1.
What is the InChIKey of pyridine-2,3-diamine;pyridine-3,5-diamine?
The InChIKey is GDJMBJUAURGFGV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H7N3/c6-4-1-5(7)3-8-2-4;6-4-2-1-3-8-5(4)7/h1-3H,6-7H2;1-3H,6H2,(H2,7,8).
What are the key properties of pyridine-2,3-diamine;pyridine-3,5-diamine?
pyridine-2,3-diamine;pyridine-3,5-diamine has a molecular weight of 218.26 g/mol, XLogP of 0.49, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-2,3-diamine;pyridine-3,5-diamine is sourced from PubChem (CID 70552694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).