C6H9FN2O — CID 70552733
3-fluoro-1,2,3,6-tetrahydropyridine-5-carboxamide (PubChem CID 70552733) has the molecular formula C6H9FN2O and a molecular weight of 144.15 g/mol. Its IUPAC name is 3-fluoro-1,2,3,6-tetrahydropyridine-5-carboxamide.
| Compound Name | 3-fluoro-1,2,3,6-tetrahydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 70552733 |
| Molecular Formula | C6H9FN2O |
| Molecular Weight | 144.15 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 3-fluoro-1,2,3,6-tetrahydropyridine-5-carboxamide |
| SMILES | NC(=O)C1=CC(F)CNC1 |
| InChI | InChI=1S/C6H9FN2O/c7-5-1-4(6(8)10)2-9-3-5/h1,5,9H,2-3H2,(H2,8,10) |
| InChIKey | CKNIKSFNBYCYEC-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.15 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |