About N-(3-chloro-2,6-dimethylphenyl)-N-[(4,6-dimethylpyrimidin-2-yl)methyl]acetamide
N-(3-chloro-2,6-dimethylphenyl)-N-[(4,6-dimethylpyrimidin-2-yl)methyl]acetamide (PubChem CID 70552983) has the molecular formula C17H20ClN3O
and a molecular weight of 317.82 g/mol. Its IUPAC name is N-(3-chloro-2,6-dimethylphenyl)-N-[(4,6-dimethylpyrimidin-2-yl)methyl]acetamide.
Molecular Properties
| Compound Name | N-(3-chloro-2,6-dimethylphenyl)-N-[(4,6-dimethylpyrimidin-2-yl)methyl]acetamide |
| PubChem CID | 70552983 |
| Molecular Formula | C17H20ClN3O |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | N-(3-chloro-2,6-dimethylphenyl)-N-[(4,6-dimethylpyrimidin-2-yl)methyl]acetamide |
| SMILES | CC(=O)N(Cc1nc(C)cc(C)n1)c1c(C)ccc(Cl)c1C |
| InChI | InChI=1S/C17H20ClN3O/c1-10-6-7-15(18)13(4)17(10)21(14(5)22)9-16-19-11(2)8-12(3)20-16/h6-8H,9H2,1-5H3 |
| InChIKey | KYMQCXFASAARTI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-chloro-2,6-dimethylphenyl)-N-[(4,6-dimethylpyrimidin-2-yl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloro-2,6-dimethylphenyl)-N-[(4,6-dimethylpyrimidin-2-yl)methyl]acetamide?
The IUPAC name of N-(3-chloro-2,6-dimethylphenyl)-N-[(4,6-dimethylpyrimidin-2-yl)methyl]acetamide (CID 70552983) is N-(3-chloro-2,6-dimethylphenyl)-N-[(4,6-dimethylpyrimidin-2-yl)methyl]acetamide.
What is the SMILES notation for N-(3-chloro-2,6-dimethylphenyl)-N-[(4,6-dimethylpyrimidin-2-yl)methyl]acetamide?
The canonical SMILES for N-(3-chloro-2,6-dimethylphenyl)-N-[(4,6-dimethylpyrimidin-2-yl)methyl]acetamide is CC(=O)N(Cc1nc(C)cc(C)n1)c1c(C)ccc(Cl)c1C.
What is the InChIKey of N-(3-chloro-2,6-dimethylphenyl)-N-[(4,6-dimethylpyrimidin-2-yl)methyl]acetamide?
The InChIKey is KYMQCXFASAARTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClN3O/c1-10-6-7-15(18)13(4)17(10)21(14(5)22)9-16-19-11(2)8-12(3)20-16/h6-8H,9H2,1-5H3.
What are the key properties of N-(3-chloro-2,6-dimethylphenyl)-N-[(4,6-dimethylpyrimidin-2-yl)methyl]acetamide?
N-(3-chloro-2,6-dimethylphenyl)-N-[(4,6-dimethylpyrimidin-2-yl)methyl]acetamide has a molecular weight of 317.82 g/mol, XLogP of 3.92, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloro-2,6-dimethylphenyl)-N-[(4,6-dimethylpyrimidin-2-yl)methyl]acetamide is sourced from PubChem (CID 70552983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).