About 1-(6,7-dihydroxynaphthalen-1-yl)-2-pyrrolidin-1-ylethanone;hydrochloride
1-(6,7-dihydroxynaphthalen-1-yl)-2-pyrrolidin-1-ylethanone;hydrochloride (PubChem CID 70553350) has the molecular formula C16H18ClNO3
and a molecular weight of 307.78 g/mol. Its IUPAC name is 1-(6,7-dihydroxynaphthalen-1-yl)-2-pyrrolidin-1-ylethanone;hydrochloride.
Molecular Properties
| Compound Name | 1-(6,7-dihydroxynaphthalen-1-yl)-2-pyrrolidin-1-ylethanone;hydrochloride |
| PubChem CID | 70553350 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 1-(6,7-dihydroxynaphthalen-1-yl)-2-pyrrolidin-1-ylethanone;hydrochloride |
| SMILES | Cl.O=C(CN1CCCC1)c1cccc2cc(O)c(O)cc12 |
| InChI | InChI=1S/C16H17NO3.ClH/c18-14-8-11-4-3-5-12(13(11)9-15(14)19)16(20)10-17-6-1-2-7-17;/h3-5,8-9,18-19H,1-2,6-7,10H2;1H |
| InChIKey | CQYZAMSJXPCMMM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 1-(6,7-dihydroxynaphthalen-1-yl)-2-pyrrolidin-1-ylethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6,7-dihydroxynaphthalen-1-yl)-2-pyrrolidin-1-ylethanone;hydrochloride?
The IUPAC name of 1-(6,7-dihydroxynaphthalen-1-yl)-2-pyrrolidin-1-ylethanone;hydrochloride (CID 70553350) is 1-(6,7-dihydroxynaphthalen-1-yl)-2-pyrrolidin-1-ylethanone;hydrochloride.
What is the SMILES notation for 1-(6,7-dihydroxynaphthalen-1-yl)-2-pyrrolidin-1-ylethanone;hydrochloride?
The canonical SMILES for 1-(6,7-dihydroxynaphthalen-1-yl)-2-pyrrolidin-1-ylethanone;hydrochloride is Cl.O=C(CN1CCCC1)c1cccc2cc(O)c(O)cc12.
What is the InChIKey of 1-(6,7-dihydroxynaphthalen-1-yl)-2-pyrrolidin-1-ylethanone;hydrochloride?
The InChIKey is CQYZAMSJXPCMMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO3.ClH/c18-14-8-11-4-3-5-12(13(11)9-15(14)19)16(20)10-17-6-1-2-7-17;/h3-5,8-9,18-19H,1-2,6-7,10H2;1H.
What are the key properties of 1-(6,7-dihydroxynaphthalen-1-yl)-2-pyrrolidin-1-ylethanone;hydrochloride?
1-(6,7-dihydroxynaphthalen-1-yl)-2-pyrrolidin-1-ylethanone;hydrochloride has a molecular weight of 307.78 g/mol, XLogP of 2.95, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6,7-dihydroxynaphthalen-1-yl)-2-pyrrolidin-1-ylethanone;hydrochloride is sourced from PubChem (CID 70553350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).