C18H30O3 — CID 70553534
14-(1,3-dioxolan-2-yl)-2-methyltetradeca-1,7,11-trien-4-ol (PubChem CID 70553534) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is 14-(1,3-dioxolan-2-yl)-2-methyltetradeca-1,7,11-trien-4-ol.
| Compound Name | 14-(1,3-dioxolan-2-yl)-2-methyltetradeca-1,7,11-trien-4-ol |
|---|---|
| PubChem CID | 70553534 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 14-(1,3-dioxolan-2-yl)-2-methyltetradeca-1,7,11-trien-4-ol |
| SMILES | C=C(C)CC(O)CCC=CCCC=CCCC1OCCO1 |
| InChI | InChI=1S/C18H30O3/c1-16(2)15-17(19)11-9-7-5-3-4-6-8-10-12-18-20-13-14-21-18/h5-8,17-19H,1,3-4,9-15H2,2H3 |
| InChIKey | JTHTYOIPFQHQFM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|