C9H14ClN5O3S — CID 70553541
(2S)-2-(2-chloroethylcarbamoylamino)-3-hydroxy-N-(1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 70553541) has the molecular formula C9H14ClN5O3S and a molecular weight of 307.76 g/mol. Its IUPAC name is (2S)-2-(2-chloroethylcarbamoylamino)-3-hydroxy-N-(1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | (2S)-2-(2-chloroethylcarbamoylamino)-3-hydroxy-N-(1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 70553541 |
| Molecular Formula | C9H14ClN5O3S |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | (2S)-2-(2-chloroethylcarbamoylamino)-3-hydroxy-N-(1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | CC(O)[C@H](NC(=O)NCCCl)C(=O)Nc1nncs1 |
| InChI | InChI=1S/C9H14ClN5O3S/c1-5(16)6(13-8(18)11-3-2-10)7(17)14-9-15-12-4-19-9/h4-6,16H,2-3H2,1H3,(H2,11,13,18)(H,14,15,17)/t5?,6-/m0/s1 |
| InChIKey | FUYQCWIDYOWKPY-GDVGLLTNSA-N |
| XLogP | -0.24 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|