C10H13BrNO2+ — CID 7055361
8-bromo-6-methoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-7-ol (PubChem CID 7055361) has the molecular formula C10H13BrNO2+ and a molecular weight of 259.12 g/mol. Its IUPAC name is 8-bromo-6-methoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-7-ol.
| Compound Name | 8-bromo-6-methoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-7-ol |
|---|---|
| PubChem CID | 7055361 |
| Molecular Formula | C10H13BrNO2+ |
| Molecular Weight | 259.12 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 8-bromo-6-methoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-7-ol |
| SMILES | COc1cc2c(c(Br)c1O)C[NH2+]CC2 |
| InChI | InChI=1S/C10H12BrNO2/c1-14-8-4-6-2-3-12-5-7(6)9(11)10(8)13/h4,12-13H,2-3,5H2,1H3/p+1 |
| InChIKey | WEYGYSPOSHISSP-UHFFFAOYSA-O |
| XLogP | 0.78 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.12 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |