C18H15Cl3N2O5S — CID 70553884
(5R)-6-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-7-oxo-2-(2,2,2-trichloroethyl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 70553884) has the molecular formula C18H15Cl3N2O5S and a molecular weight of 477.75 g/mol. Its IUPAC name is (5R)-6-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-7-oxo-2-(2,2,2-trichloroethyl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (5R)-6-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-7-oxo-2-(2,2,2-trichloroethyl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 70553884 |
| Molecular Formula | C18H15Cl3N2O5S |
| Molecular Weight | 477.75 g/mol |
| Exact Mass | 475.98 |
| IUPAC Name | (5R)-6-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-7-oxo-2-(2,2,2-trichloroethyl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@@H]2C(N3C(=O)c4ccccc4C3=O)C(=O)N2C1(CC(Cl)(Cl)Cl)C(=O)O |
| InChI | InChI=1S/C18H15Cl3N2O5S/c1-16(2)17(15(27)28,7-18(19,20)21)23-13(26)10(14(23)29-16)22-11(24)8-5-3-4-6-9(8)12(22)25/h3-6,10,14H,7H2,1-2H3,(H,27,28)/t10?,14-,17?/m1/s1 |
| InChIKey | AGRYDGQKJXDQLA-FBUIMKQZSA-N |
| XLogP | 2.93 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.75 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|