C17H15NO2 — CID 705541
2,5-dimethyl-N-naphthalen-1-ylfuran-3-carboxamide (PubChem CID 705541) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2,5-dimethyl-N-naphthalen-1-ylfuran-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-naphthalen-1-ylfuran-3-carboxamide |
|---|---|
| PubChem CID | 705541 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2,5-dimethyl-N-naphthalen-1-ylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc3ccccc23)c(C)o1 |
| InChI | InChI=1S/C17H15NO2/c1-11-10-15(12(2)20-11)17(19)18-16-9-5-7-13-6-3-4-8-14(13)16/h3-10H,1-2H3,(H,18,19) |
| InChIKey | AYSMJTDFZSGXOB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |